then find the numbers. Mr. Bidur Bastola

The sum of0:07:31

The sum of ages of mother and her daughter is 83 years, when the mother age was equal to the present

The sum of0:07:01

The sum of the ages of father and son is 45 yrs. If both live on until the son's age becomes equal..

Solving two variable0:22:19

Solving two variable equations by elimination method...

The semi- annual0:18:28

The semi- annual compound amounts on a sum of money in 15 months and 21 months are Rs. 12705 and Rs.

If 'S' is0:14:23

If 'S' is the sum of the terms of G.P. 'P' is the product of the terms of G.P and 'R' is the sum of

Important question from0:13:05

Important question from sequence and series...

Rs. 9000 were0:12:15

Rs. 9000 were divided equally among a certain number of students. Had there been 20 more students...

If l^th ,0:10:10

If l^th , m^th and n^th terms of a GP are in GP then show that l,m and n are in AP.

If a^x =0:09:11

If a^x = b^y = c^z and b^2 = ac then prove that :- 2/y = 1/x + 1/z.

Second Part of1:03:36

Second Part of Some important prove questions of trigonometry from class 8 and 9...

If l, m0:06:55

If l, m and n are in A.P and p, q and r are in G.P then prove that: p^(m-n). q^(n-l). r^(l-m) = 1.

If the Q30:12:24

If the Q3 or third quartile of the data is 60, then find the value of 'm'.

Prove that: tan0:15:30

Prove that: tan 6°.tan 42°.tan 66°.tan 78° = 1

Problem related to0:11:15

Problem related to two digits number.

If A+B+C=180⁰ then0:07:10

If A+B+C=180⁰ then prove that: cot 2A. cot 2B + cot 2B. cot 2C + cot 2C. cot 2A = 1

If a,b,c are0:15:40

If a,b,c are pth, qth and rth term of an A.P, prove that : p(b-c)+q(c-a)+r(a-b)=0.

If a^x =0:06:36

If a^x = b^y = c^z and abc = 1, then prove that:- 1/x + 1/y + 1/z = 0.

If the line0:13:25

If the line x/a + y/b = 1 passes through the point of intersection of the lines x+y=3 and 2x-3y=1

Important question from0:14:46

Important question from the geometry of class 9...

If A+B+C=180° then0:17:26

If A+B+C=180° then prove that: sin(B+2C)+sin(C+2A)+sin(A+2B) = 4sin(B-C)/2.sin(C-A)/2.sin(A-B)/2.

Prove that: cosec10°0:10:03

Prove that: cosec10° - √3 sec10° = 4

In the given0:14:27

In the given figure O is the centre of the circle. AB the diameter and DO perpendicular to AB then..

Prove that: sin⁴0:05:48

Prove that: sin⁴ A = 3/8 - 1/2 cos 2A + 1/8 cos 4A

If the line0:17:09

If the line xcosA+ysinA = P passes through the point of intersection of lines X=2y and x-y+1=0 and..

Назад